| product Name |
2,3-dimethyl-6-nitro-2H-indazole |
| Synonyms |
2H-indazole, 2,3-dimethyl-6-nitro- |
| Molecular Formula |
C9H9N3O2 |
| Molecular Weight |
191.1867 |
| InChI |
InChI=1/C9H9N3O2/c1-6-8-4-3-7(12(13)14)5-9(8)10-11(6)2/h3-5H,1-2H3 |
| CAS Registry Number |
444731-73-1 |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Boiling point |
377.033°C at 760 mmHg |
| Refractive index |
1.655 |
| Flash point |
181.824°C |
| Vapour Pressur |
0mmHg at 25°C |
| Uses |
2,3-Dimethyl-6-nitro-2H-indazole is an impurity in the synthesis of Pazopanib (P210925) hydrochloride, an oral angiogenesis inhibitor targeting VEGFR and PDGFR. |
| structure and hydrogen bonding |
In the mol-ecule of 2,3-dimethyl-6-nitro-2H-indazole, C9H9N3O2, the indazole ring system is almost planar [maximum deviation = 0.019 (3) Å for the C atom bearing the nitro group]. In the crystal structure, inter-molecular C—H…O inter-actions link the mol-ecules into centrosymmetric dimers, forming R 2 2(18) ring motifs. Aromatic π–π contacts between indazole rings [centroid–centroid distances = 3.632 (1) and 3.705 (1)?] may further stabilize the structure[1]. |
Reviews
There are no reviews yet.