| product Name |
6-Iodo-1H-indazole |
| Synonyms |
6-iodo (1H)indazole; 1H-indazole, 6-iodo-; 6-Iodoindazole |
| Molecular Formula |
C7H5IN2 |
| Molecular Weight |
244.0325 |
| InChI |
InChI=1/C7H5IN2/c8-6-2-1-5-4-9-10-7(5)3-6/h1-4H,(H,9,10) |
| CAS Registry Number |
261953-36-0 |
| Molecular Structure |
|
| Density |
2.083g/cm3 |
| Boiling point |
358.187°C at 760 mmHg |
| Refractive index |
1.788 |
| Flash point |
170.426°C |
| Vapour Pressur |
0mmHg at 25°C |
| Uses |
6-Iodo-1H-indazole is an intermediate used to synthesize inhibitors of Chk1. |
| Physical Form |
Light yellow to Brown powder to crystal |
Reviews
There are no reviews yet.