| product Name |
2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ester |
| Synonyms |
Ethyl 4,5-bis(2-methoxyethoxy)-2-aminobenzoate; 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester; 4,5-Bis(2-methoxyethoxy)anthranilic acid ethyl ester; ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate; Benzoic acid,4,5-bis(2-methoxyethoxy)-2-amino-,ethylester |
| Molecular Formula |
C15H23NO6 |
| Molecular Weight |
313.3462 |
| InChI |
InChI=1/C15H23NO6/c1-4-20-15(17)11-9-13(21-7-5-18-2)14(10-12(11)16)22-8-6-19-3/h9-10H,4-8,16H2,1-3H3 |
| CAS Registry Number |
179688-27-8 |
| Molecular Structure |
|
| Density |
1.148g/cm3 |
| Boiling point |
456.4°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
183.9°C |
| Vapour Pressur |
1.62E-08mmHg at 25°C |
| Uses |
2-Amino-4,5-bis(2-methoxyethoxy)benzoic Acid Ethyl Ester is an intermediate in the synthesis of Erlotinib (E625000, HCl); a selective epidermal growth factor receptor (EGFR)-tyrosine kinase inhibitor and antineoplastic agent. |
Reviews
There are no reviews yet.