| product Name |
6-methoxypyridazin-3-amine |
| Synonyms |
3-AMINO-6-METHOXYPYRIDAZINE; 3-amino-6-methoxypyridazine Hydrochloride |
| Molecular Formula |
C5H7N3O |
| Molecular Weight |
125.1286 |
| InChI |
InChI=1/C5H7N3O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3,(H2,6,7) |
| CAS Registry Number |
7252-84-8 |
| EINECS |
230-670-1 |
| Molecular Structure |
|
| Density |
1.224g/cm3 |
| Boiling point |
353.5°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
167.6°C |
| Vapour Pressur |
3.57E-05mmHg at 25°C |
| Uses |
3-Amino-6-methoxypyridazine is an organic reagent that can be used as a key intermediate in the preparation of Relugoli. |
| Raw materials |
Sulfamethoxypyridazine–>6-Chloropyridazin-3-amine–>3-CHLORO-6-METHOXYPYRIDAZINE |
Reviews
There are no reviews yet.