| product Name |
4-(3-fluorobenzyloxy)-3-chlorobenzenamine |
| Synonyms |
3-Chloro-4-(3-fluorobenzyloxy)-aniline; 3-chloro-4-(3-fluorobenzyloxy)aniline; 3-Chloro-4-(3-fluoro-benzyloxy)-phenylamine |
| Molecular Formula |
C13H11ClFNO |
| Molecular Weight |
251.6839 |
| InChI |
InChI=1/C13H11ClFNO/c14-12-7-11(16)4-5-13(12)17-8-9-2-1-3-10(15)6-9/h1-7H,8,16H2 |
| CAS Registry Number |
202197-26-0 |
| Molecular Structure |
|
| Density |
1.306g/cm3 |
| Boiling point |
387.9°C at 760 mmHg |
| Refractive index |
1.607 |
| Flash point |
188.4°C |
| Vapour Pressur |
3.19E-06mmHg at 25°C |
| Chemical Properties |
Tan Solid |
| Uses |
3-Chloro-4-(3-fluorobenzyloxy)aniline is an intermediate in the synthesis of Lapatinib (L175800). |
Reviews
There are no reviews yet.