| product Name | H-Ala-OiPr.HCl |
|---|---|
| Synonyms | L-Alanine isopropyl ester hydrochloride; H-ALA-OIPR HCL; isopropyl (2S)-2-aminopropanoate hydrochloride; Isopropyl L-alaninate hydrochloride (1:1); L-Alanine, 1-methylethyl ester, hydrochloride (1:1); L-Alanine, 1-methylethyl ester, hydrochloride; H-Ala-OiPr• HCl; L-Alanine Isopropyl Ester Hcl; H-Ala-OiPr.hydrochloride |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.6339 |
| InChI | InChI=1/C6H13NO2.ClH/c1-4(2)9-6(8)5(3)7;/h4-5H,7H2,1-3H3;1H/t5-;/m0./s1 |
| CAS Registry Number | 62062-65-1 |
| Molecular Structure | 
|
| Boiling point | 191.4°C at 760 mmHg |
| Flash point | 69.5°C |
| Vapour Pressur | 0.438mmHg at 25°C |
| Color | White to Orange to Green |
| Uses | 1.L-Alanine isopropyl ester hydrochloride is a reagent used in the synthesis of anti- hepatitis C virus prodrugs based on imidazotriazine and pyrrolotriazine molecules. Further, it reacts with (1R:2R)-2-Hydroxy-πnanone-3 to prepare isopropyl (1R,2R,5R)-2′-[(2-hydroxypinan-3-ylene)amino]propanoate.
2. (S)-Isopropyl-2-aminopropanoate Hydrochloride, is a chemical reagent used in the synthesis of anti-HCV prodrugs based on imidazotriazine and pyrrolotriazine molecules. |
Reviews
There are no reviews yet.