| product Name |
4-Quinazolinamine, N-(3-chloro-4-fluorophenyl)-7-fluoro-6-nitro- |
| Synonyms |
N-(3-chloro-4-fluoro-phenyl)-7-fluoro-6-nitro-quinazolin-4-amine; N-(3-chloro-4-fluorophenyl)-7-fluoro-6-nitro-4-Quinazolinamine; N-(3-chloro-4-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine; N-(3-Chloro-4-fluorophenyl)(7-fluoro-6-nitroquinazolin-4-yl)amine |
| Molecular Formula |
C14H7ClF2N4O2 |
| Molecular Weight |
336.6808 |
| InChI |
InChI=1/C14H7ClF2N4O2/c15-9-3-7(1-2-10(9)16)20-14-8-4-13(21(22)23)11(17)5-12(8)18-6-19-14/h1-6H,(H,18,19,20) |
| CAS Registry Number |
162012-67-1 |
| Molecular Structure |
|
| Density |
1.617g/cm3 |
| Boiling point |
488.589°C at 760 mmHg |
| Refractive index |
1.707 |
| Flash point |
249.29°C |
| Vapour Pressur |
0mmHg at 25°C |
| Uses |
4-(3-Chloro-4-fluorophenylamino)-7-fluoro-6-nitroquninazoline is an intermediate in the synthesis of Afatinib (A355300), an aminocrotonylamino-substituted quinazoline derivative used for treating cancer and diseases of the respiratory tract, lungs, gastrointestinal tract, bile duct, and gallbladder. |
Reviews
There are no reviews yet.