| product Name | 1-(3-Pyridyl)-3-(dimethylamino)-2-propen-1-one |
|---|---|
| Synonyms | 3-(Dimethylamino)-1-(3-pyridinyl)-2-propen-1-one; 3-(dimethylamino)-1-(pyridin-3-yl)prop-2-en-1-one; (2E)-3-(dimethylamino)-1-pyridin-3-ylprop-2-en-1-one; (2E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.2151 |
| InChI | InChI=1/C10H12N2O/c1-12(2)8-5-10(13)9-3-6-11-7-4-9/h3-8H,1-2H3/b8-5+ |
| CAS Registry Number | 55314-16-4 |
| Molecular Structure | 
|
| Density | 1.07g/cm3 |
| Boiling point | 281.4°C at 760 mmHg |
| Refractive index | 1.545 |
| Flash point | 124°C |
| Vapour Pressur | 0.00356mmHg at 25°C |
| Description | 1-(3-Pyridyl)-3-(dimethylamino)-2-propen-1-one can be used in the synthesis of imatinib and nilotinib (AMN107), a compound currently in multiple Phase II/III clinical trials for chronic granulocytic leukaemia. Imatinib, on the other hand, is a cancer growth blocker known as a tyrosine kinase inhibitor (TKI), which is used to treat a wide range of leukaemias, myelodysplastic/myeloproliferative disorders, systemic mastocytosis, eosinophilia syndromes, raised dermal fibrosarcoma and gastrointestinal mesenchymal tumours. |
| Uses | 1.Rasagiline intermediate
2.3-Dimethylamino-1-(3-pyridyl)-2-propen-1-one is used ads pharmaceutical intermediate, an imatinib intermediate. |
Reviews
There are no reviews yet.