| product Name |
4-amino-3-chlorophenol |
| Synonyms |
3-13-00-01184 (Beilstein Handbook Reference); 3-Chloro-4-aminophenol; BRN 2802558; Phenol, 4-amino-3-chloro-; AMINO(4-)-3-CHLOROPHENOL |
| Molecular Formula |
C6H6ClNO |
| Molecular Weight |
143.57 |
| InChI |
InChI=1S/C6H6ClNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 |
| CAS Registry Number |
17609-80-2 |
| EINECS |
241-583-3 |
| Molecular Structure |
|
| Density |
1.43g/cm3 |
| Boiling point |
294.4°C at 760 mmHg |
| Refractive index |
1.606 |
| Flash point |
131.8°C |
| Vapour Pressur |
0.00074mmHg at 25°C |
| Chemical Properties |
Light yellow solid |
| Uses |
4-Amino-3-Chlorophenol acts as a synthetic reagent for the preparation of Benzothiazole-based ureas as potential ABAD/17β-HSD10 modulators for Alzheimer”s disease treatment. |
| Application |
The 4-amino-3-chlorophenol is a crucial intermediate for preparing a tyrosine kinase inhibitor, tivozanib, and a late liver cancer drug, lenvatinib. As a crucial pharmaceutical chemical intermediate, 4-amino-3-chlorophenol is widely applied to the design and synthesis of medicaments for resisting tumors, cardiovascular diseases, neurological diseases, and the like. |
Reviews
There are no reviews yet.