| product Name |
4-(3-chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ol |
| Synonyms |
4-(3-Chloro-4-fluorophenylamino)-6-hydroxy-7-methoxyquinazoline; 4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinol; O-Desmorpholinopropyl Gefitinib |
| Molecular Formula |
C15H11ClFN3O2 |
| Molecular Weight |
319.7181 |
| InChI |
InChI=1/C15H11ClFN3O2/c1-22-14-6-12-9(5-13(14)21)15(19-7-18-12)20-8-2-3-11(17)10(16)4-8/h2-7,21H,1H3,(H,18,19,20) |
| CAS Registry Number |
184475-71-6 |
| Molecular Structure |
|
| Density |
1.49g/cm3 |
| Boiling point |
478.809°C at 760 mmHg |
| Refractive index |
1.702 |
| Flash point |
243.375°C |
| Vapour Pressur |
0mmHg at 25°C |
| Description |
O-Desmorpholinopropyl Gefitinib is a metabolite of Gefitinib, a potent inhibitor of tyrosine phosporylation in EGFR. The chemical structure of O-Desmorpholinopropyl Gefitinib consists of a quinazoline-6-ol core with a phenylamino group attached to a chloro-fluoro-phenyl ring, enabling it to interact with multiple biological targets. It is involved in inhibiting enzymes such as cyclooxygenase-2 (COX-2) and inducible nitric oxide synthase (iNOS). |
| Chemical Properties |
Tan Solid |
| Uses |
A metabolite of Gefitinib. |
Reviews
There are no reviews yet.